 Product categoryFriends links |
|
 Click on the image to check the artwork |
|
| product: |
view count: 37Hydroxypropyl Acrylate |
| unit price: |
Negotiable |
| min amount: |
|
| amount: |
|
| period for delivery: |
Consignment Deadline days |
| Expiry date: |
Long Effective |
| last update: |
2017-10-12 15:19 |
| |
 |
|
Hydroxypropyl Acrylate
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
25584-83-2 |
| EC NO: |
247-118-0 |
| Molecular Formula: |
C6H10O3
|
| Molecular Weight: |
130.1418 |
| Specification: |
|
| InChI: |
InChI=1/C6H10O3/c1-3-5(7)9-6(8)4-2/h3,6,8H,1,4H2,2H3 |
| Synonyms: |
Hydroxypropyl acrylate,mixture of isomers;Acrylic acid hydroxypropyl ester;BISOMER HPA;2-hydroxypropyl prop-2-enoate;1-hydroxypropan-2-yl prop-2-enoate;1-hydroxypropyl prop-2-enoate;Hydroxypropyl acrylate; |
| Molecular Structure: |
 |
|
